C13H22N2O — CID 79588986
4-N,4-N-dimethyl-2-(3-methylbutoxy)benzene-1,4-diamine (PubChem CID 79588986) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-(3-methylbutoxy)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-(3-methylbutoxy)benzene-1,4-diamine |
|---|---|
| PubChem CID | 79588986 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-N,4-N-dimethyl-2-(3-methylbutoxy)benzene-1,4-diamine |
| SMILES | CC(C)CCOc1cc(N(C)C)ccc1N |
| InChI | InChI=1S/C13H22N2O/c1-10(2)7-8-16-13-9-11(15(3)4)5-6-12(13)14/h5-6,9-10H,7-8,14H2,1-4H3 |
| InChIKey | NPKGNSSXFLEKKD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|