C17H21FN2O — CID 107258842
2-fluoro-5-methoxy-1-N-methyl-1-N-(3-phenylpropyl)benzene-1,4-diamine (PubChem CID 107258842) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-1-N-methyl-1-N-(3-phenylpropyl)benzene-1,4-diamine.
| Compound Name | 2-fluoro-5-methoxy-1-N-methyl-1-N-(3-phenylpropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 107258842 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-fluoro-5-methoxy-1-N-methyl-1-N-(3-phenylpropyl)benzene-1,4-diamine |
| SMILES | COc1cc(N(C)CCCc2ccccc2)c(F)cc1N |
| InChI | InChI=1S/C17H21FN2O/c1-20(10-6-9-13-7-4-3-5-8-13)16-12-17(21-2)15(19)11-14(16)18/h3-5,7-8,11-12H,6,9-10,19H2,1-2H3 |
| InChIKey | LSXUCZMXXZVCCU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|