C17H18O4 — CID 11977890
3-phenylpropyl 4-hydroxy-3-methoxybenzoate (PubChem CID 11977890) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-phenylpropyl 4-hydroxy-3-methoxybenzoate.
| Compound Name | 3-phenylpropyl 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 11977890 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-phenylpropyl 4-hydroxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCc2ccccc2)ccc1O |
| InChI | InChI=1S/C17H18O4/c1-20-16-12-14(9-10-15(16)18)17(19)21-11-5-8-13-6-3-2-4-7-13/h2-4,6-7,9-10,12,18H,5,8,11H2,1H3 |
| InChIKey | LPFSJRYKCHAQGZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|