About 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline
5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline (PubChem CID 82183962) has the molecular formula C17H22N2O2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline.
Molecular Properties
| Compound Name | 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline |
| PubChem CID | 82183962 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline |
| SMILES | CCN(Cc1cc(N)c(OC)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-19(14-8-6-5-7-9-14)12-13-10-15(18)17(21-3)16(11-13)20-2/h5-11H,4,12,18H2,1-3H3 |
| InChIKey | BECAMNFFCUFVHC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline?
The IUPAC name of 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline (CID 82183962) is 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline.
What is the SMILES notation for 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline?
The canonical SMILES for 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline is CCN(Cc1cc(N)c(OC)c(OC)c1)c1ccccc1.
What is the InChIKey of 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline?
The InChIKey is BECAMNFFCUFVHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-4-19(14-8-6-5-7-9-14)12-13-10-15(18)17(21-3)16(11-13)20-2/h5-11H,4,12,18H2,1-3H3.
What are the key properties of 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline?
5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline has a molecular weight of 286.38 g/mol, XLogP of 3.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(N-ethylanilino)methyl]-2,3-dimethoxyaniline is sourced from PubChem (CID 82183962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).