C22H23NO4 — CID 18996720
2,3,4,5-tetramethoxy-N,N-diphenylaniline (PubChem CID 18996720) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2,3,4,5-tetramethoxy-N,N-diphenylaniline.
| Compound Name | 2,3,4,5-tetramethoxy-N,N-diphenylaniline |
|---|---|
| PubChem CID | 18996720 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2,3,4,5-tetramethoxy-N,N-diphenylaniline |
| SMILES | COc1cc(N(c2ccccc2)c2ccccc2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C22H23NO4/c1-24-19-15-18(20(25-2)22(27-4)21(19)26-3)23(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-15H,1-4H3 |
| InChIKey | LYIVEJFRDZEYKC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |