C21H21NO3 — CID 54235747
2-methoxy-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 54235747) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-methoxy-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 2-methoxy-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 54235747 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-methoxy-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-23-18-12-8-16(9-13-18)22(17-10-14-19(24-2)15-11-17)20-6-4-5-7-21(20)25-3/h4-15H,1-3H3 |
| InChIKey | QMLCQHUWMZTORP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |