C40H35NO2 — CID 76816285
2,4-dimethoxy-N,N-bis[4-(4-phenylbuta-1,3-dienyl)phenyl]aniline (PubChem CID 76816285) has the molecular formula C40H35NO2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2,4-dimethoxy-N,N-bis[4-(4-phenylbuta-1,3-dienyl)phenyl]aniline.
| Compound Name | 2,4-dimethoxy-N,N-bis[4-(4-phenylbuta-1,3-dienyl)phenyl]aniline |
|---|---|
| PubChem CID | 76816285 |
| Molecular Formula | C40H35NO2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 2,4-dimethoxy-N,N-bis[4-(4-phenylbuta-1,3-dienyl)phenyl]aniline |
| SMILES | COc1ccc(N(c2ccc(C=CC=Cc3ccccc3)cc2)c2ccc(C=CC=Cc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C40H35NO2/c1-42-38-29-30-39(40(31-38)43-2)41(36-25-21-34(22-26-36)19-11-9-17-32-13-5-3-6-14-32)37-27-23-35(24-28-37)20-12-10-18-33-15-7-4-8-16-33/h3-31H,1-2H3 |
| InChIKey | QKBRECLXUDSXRH-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|