C37H33NO — CID 154951531
2-methoxy-N,N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]aniline (PubChem CID 154951531) has the molecular formula C37H33NO and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-methoxy-N,N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]aniline.
| Compound Name | 2-methoxy-N,N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 154951531 |
| Molecular Formula | C37H33NO |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 2-methoxy-N,N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]aniline |
| SMILES | COc1ccccc1N(c1ccc(/C=C/c2ccc(C)cc2)cc1)c1ccc(/C=C/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H33NO/c1-28-8-12-30(13-9-28)16-18-32-20-24-34(25-21-32)38(36-6-4-5-7-37(36)39-3)35-26-22-33(23-27-35)19-17-31-14-10-29(2)11-15-31/h4-27H,1-3H3/b18-16+,19-17+ |
| InChIKey | GHVMOXTXDPMULQ-YWNVXTCZSA-N |
| XLogP | 10.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|