C29H27NO3 — CID 69462204
3-methoxy-N-(3-methoxyphenyl)-N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]aniline (PubChem CID 69462204) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-methoxy-N-(3-methoxyphenyl)-N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]aniline.
| Compound Name | 3-methoxy-N-(3-methoxyphenyl)-N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 69462204 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-methoxy-N-(3-methoxyphenyl)-N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]aniline |
| SMILES | COc1cccc(/C=C/c2ccc(N(c3cccc(OC)c3)c3cccc(OC)c3)cc2)c1 |
| InChI | InChI=1S/C29H27NO3/c1-31-27-10-4-7-23(19-27)14-13-22-15-17-24(18-16-22)30(25-8-5-11-28(20-25)32-2)26-9-6-12-29(21-26)33-3/h4-21H,1-3H3/b14-13+ |
| InChIKey | WCRQHIXLGJDKKO-BUHFOSPRSA-N |
| XLogP | 7.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|