C17H19NO — CID 89046788
3-[(E)-2-(3-methoxyphenyl)ethenyl]-N,N-dimethylaniline (PubChem CID 89046788) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-[(E)-2-(3-methoxyphenyl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 3-[(E)-2-(3-methoxyphenyl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 89046788 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-[(E)-2-(3-methoxyphenyl)ethenyl]-N,N-dimethylaniline |
| SMILES | COc1cccc(/C=C/c2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C17H19NO/c1-18(2)16-8-4-6-14(12-16)10-11-15-7-5-9-17(13-15)19-3/h4-13H,1-3H3/b11-10+ |
| InChIKey | OYONBBLZUIRFKY-ZHACJKMWSA-N |
| XLogP | 3.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|