About 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline
3-(3-bromoprop-1-enyl)-N,N-dimethylaniline (PubChem CID 169475509) has the molecular formula C11H14BrN
and a molecular weight of 240.14 g/mol. Its IUPAC name is 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline |
| PubChem CID | 169475509 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C=CCBr)c1 |
| InChI | InChI=1S/C11H14BrN/c1-13(2)11-7-3-5-10(9-11)6-4-8-12/h3-7,9H,8H2,1-2H3 |
| InChIKey | BQCNOBGMUKQRPC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline?
The IUPAC name of 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline (CID 169475509) is 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline.
What is the SMILES notation for 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline?
The canonical SMILES for 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline is CN(C)c1cccc(C=CCBr)c1.
What is the InChIKey of 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline?
The InChIKey is BQCNOBGMUKQRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN/c1-13(2)11-7-3-5-10(9-11)6-4-8-12/h3-7,9H,8H2,1-2H3.
What are the key properties of 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline?
3-(3-bromoprop-1-enyl)-N,N-dimethylaniline has a molecular weight of 240.14 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromoprop-1-enyl)-N,N-dimethylaniline is sourced from PubChem (CID 169475509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).