C32H26Br2N2O2 — CID 101442769
1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-diamine (PubChem CID 101442769) has the molecular formula C32H26Br2N2O2 and a molecular weight of 630.38 g/mol. Its IUPAC name is 1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 101442769 |
| Molecular Formula | C32H26Br2N2O2 |
| Molecular Weight | 630.38 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | 1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-diamine |
| SMILES | COc1ccccc1N(c1cccc(Br)c1)c1cccc(N(c2cccc(Br)c2)c2ccccc2OC)c1 |
| InChI | InChI=1S/C32H26Br2N2O2/c1-37-31-18-5-3-16-29(31)35(25-12-7-10-23(33)20-25)27-14-9-15-28(22-27)36(26-13-8-11-24(34)21-26)30-17-4-6-19-32(30)38-2/h3-22H,1-2H3 |
| InChIKey | MBSHGCOOTOMTAU-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.38 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |