About N-(3-bromophenyl)-N,2-dimethylaniline
N-(3-bromophenyl)-N,2-dimethylaniline (PubChem CID 146003911) has the molecular formula C14H14BrN
and a molecular weight of 276.18 g/mol. Its IUPAC name is N-(3-bromophenyl)-N,2-dimethylaniline.
Molecular Properties
| Compound Name | N-(3-bromophenyl)-N,2-dimethylaniline |
| PubChem CID | 146003911 |
| Molecular Formula | C14H14BrN |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-(3-bromophenyl)-N,2-dimethylaniline |
| SMILES | Cc1ccccc1N(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H14BrN/c1-11-6-3-4-9-14(11)16(2)13-8-5-7-12(15)10-13/h3-10H,1-2H3 |
| InChIKey | CCTFPLVFZLCFLZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3-bromophenyl)-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)-N,2-dimethylaniline?
The IUPAC name of N-(3-bromophenyl)-N,2-dimethylaniline (CID 146003911) is N-(3-bromophenyl)-N,2-dimethylaniline.
What is the SMILES notation for N-(3-bromophenyl)-N,2-dimethylaniline?
The canonical SMILES for N-(3-bromophenyl)-N,2-dimethylaniline is Cc1ccccc1N(C)c1cccc(Br)c1.
What is the InChIKey of N-(3-bromophenyl)-N,2-dimethylaniline?
The InChIKey is CCTFPLVFZLCFLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN/c1-11-6-3-4-9-14(11)16(2)13-8-5-7-12(15)10-13/h3-10H,1-2H3.
What are the key properties of N-(3-bromophenyl)-N,2-dimethylaniline?
N-(3-bromophenyl)-N,2-dimethylaniline has a molecular weight of 276.18 g/mol, XLogP of 4.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)-N,2-dimethylaniline is sourced from PubChem (CID 146003911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).