C14H14BrN — CID 146003911
N-(3-bromophenyl)-N,2-dimethylaniline (PubChem CID 146003911) has the molecular formula C14H14BrN and a molecular weight of 276.18 g/mol. Its IUPAC name is N-(3-bromophenyl)-N,2-dimethylaniline.
| Compound Name | N-(3-bromophenyl)-N,2-dimethylaniline |
|---|---|
| PubChem CID | 146003911 |
| Molecular Formula | C14H14BrN |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-(3-bromophenyl)-N,2-dimethylaniline |
| SMILES | Cc1ccccc1N(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H14BrN/c1-11-6-3-4-9-14(11)16(2)13-8-5-7-12(15)10-13/h3-10H,1-2H3 |
| InChIKey | CCTFPLVFZLCFLZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |