About 3-bromo-5-(N,2-dimethylanilino)benzonitrile
3-bromo-5-(N,2-dimethylanilino)benzonitrile (PubChem CID 102816101) has the molecular formula C15H13BrN2
and a molecular weight of 301.19 g/mol. Its IUPAC name is 3-bromo-5-(N,2-dimethylanilino)benzonitrile.
Molecular Properties
| Compound Name | 3-bromo-5-(N,2-dimethylanilino)benzonitrile |
| PubChem CID | 102816101 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-bromo-5-(N,2-dimethylanilino)benzonitrile |
| SMILES | Cc1ccccc1N(C)c1cc(Br)cc(C#N)c1 |
| InChI | InChI=1S/C15H13BrN2/c1-11-5-3-4-6-15(11)18(2)14-8-12(10-17)7-13(16)9-14/h3-9H,1-2H3 |
| InChIKey | HRISUMZLDKIMBJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-(N,2-dimethylanilino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(N,2-dimethylanilino)benzonitrile?
The IUPAC name of 3-bromo-5-(N,2-dimethylanilino)benzonitrile (CID 102816101) is 3-bromo-5-(N,2-dimethylanilino)benzonitrile.
What is the SMILES notation for 3-bromo-5-(N,2-dimethylanilino)benzonitrile?
The canonical SMILES for 3-bromo-5-(N,2-dimethylanilino)benzonitrile is Cc1ccccc1N(C)c1cc(Br)cc(C#N)c1.
What is the InChIKey of 3-bromo-5-(N,2-dimethylanilino)benzonitrile?
The InChIKey is HRISUMZLDKIMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN2/c1-11-5-3-4-6-15(11)18(2)14-8-12(10-17)7-13(16)9-14/h3-9H,1-2H3.
What are the key properties of 3-bromo-5-(N,2-dimethylanilino)benzonitrile?
3-bromo-5-(N,2-dimethylanilino)benzonitrile has a molecular weight of 301.19 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(N,2-dimethylanilino)benzonitrile is sourced from PubChem (CID 102816101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).