C18H22O4 — CID 174438503
1,2,3,4-tetramethoxy-5-(2-phenylethyl)benzene (PubChem CID 174438503) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1,2,3,4-tetramethoxy-5-(2-phenylethyl)benzene.
| Compound Name | 1,2,3,4-tetramethoxy-5-(2-phenylethyl)benzene |
|---|---|
| PubChem CID | 174438503 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1,2,3,4-tetramethoxy-5-(2-phenylethyl)benzene |
| SMILES | COc1cc(CCc2ccccc2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C18H22O4/c1-19-15-12-14(11-10-13-8-6-5-7-9-13)16(20-2)18(22-4)17(15)21-3/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | QTZYTHXECNCLSY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |