C24H25NO6 — CID 175169197
phenyl 5-[2-(2,3,4,5-tetramethoxyphenyl)ethyl]pyridine-3-carboxylate (PubChem CID 175169197) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is phenyl 5-[2-(2,3,4,5-tetramethoxyphenyl)ethyl]pyridine-3-carboxylate.
| Compound Name | phenyl 5-[2-(2,3,4,5-tetramethoxyphenyl)ethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 175169197 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | phenyl 5-[2-(2,3,4,5-tetramethoxyphenyl)ethyl]pyridine-3-carboxylate |
| SMILES | COc1cc(CCc2cncc(C(=O)Oc3ccccc3)c2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C24H25NO6/c1-27-20-13-17(21(28-2)23(30-4)22(20)29-3)11-10-16-12-18(15-25-14-16)24(26)31-19-8-6-5-7-9-19/h5-9,12-15H,10-11H2,1-4H3 |
| InChIKey | UCGLZNSIWUUGGY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|