C25H30N4O4 — CID 164754536
2-[2-[bis(2-pyridin-3-ylethyl)amino]-3,4,5-trimethoxyphenyl]acetamide (PubChem CID 164754536) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[2-[bis(2-pyridin-3-ylethyl)amino]-3,4,5-trimethoxyphenyl]acetamide.
| Compound Name | 2-[2-[bis(2-pyridin-3-ylethyl)amino]-3,4,5-trimethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 164754536 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[2-[bis(2-pyridin-3-ylethyl)amino]-3,4,5-trimethoxyphenyl]acetamide |
| SMILES | COc1cc(CC(N)=O)c(N(CCc2cccnc2)CCc2cccnc2)c(OC)c1OC |
| InChI | InChI=1S/C25H30N4O4/c1-31-21-14-20(15-22(26)30)23(25(33-3)24(21)32-2)29(12-8-18-6-4-10-27-16-18)13-9-19-7-5-11-28-17-19/h4-7,10-11,14,16-17H,8-9,12-13,15H2,1-3H3,(H2,26,30) |
| InChIKey | XUCCTMBENQHMDU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|