C15H14ClNO4 — CID 91682617
methyl 3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)benzoate (PubChem CID 91682617) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is methyl 3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)benzoate.
| Compound Name | methyl 3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 91682617 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | methyl 3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)benzoate |
| SMILES | COC(=O)c1cc(Cl)c(OCc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C15H14ClNO4/c1-19-13-7-11(15(18)20-2)6-12(16)14(13)21-9-10-4-3-5-17-8-10/h3-8H,9H2,1-2H3 |
| InChIKey | QDMKLTIQSUGHDC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |