C21H18Cl2N2O4 — CID 17058523
2-chloro-5-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]benzoic acid (PubChem CID 17058523) has the molecular formula C21H18Cl2N2O4 and a molecular weight of 433.29 g/mol. Its IUPAC name is 2-chloro-5-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]benzoic acid.
| Compound Name | 2-chloro-5-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 17058523 |
| Molecular Formula | C21H18Cl2N2O4 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-chloro-5-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]benzoic acid |
| SMILES | COc1cc(CNc2ccc(Cl)c(C(=O)O)c2)cc(Cl)c1OCc1cccnc1 |
| InChI | InChI=1S/C21H18Cl2N2O4/c1-28-19-8-14(11-25-15-4-5-17(22)16(9-15)21(26)27)7-18(23)20(19)29-12-13-3-2-6-24-10-13/h2-10,25H,11-12H2,1H3,(H,26,27) |
| InChIKey | KUVXLQMFWFZOLD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |