3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid

C22H22N2O4 — CID 68522894

IUPAC3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid
SMILESCOc1ccc(N(CCc2cccnc2)c2cccc(C(=O)O)c2)cc1OC
InChIInChI=1S/C22H22N2O4/c1-27-20-9-8-19(14-21(20)28-2)24(12-10-16-5-4-11-23-15-16)18-7-3-6-17(13-18)22(25)26/h3-9,11,13-15H,10,12H2,1-2H3,(H,25,26)
InChIKeyDMKWGKGPFAPKPI-UHFFFAOYSA-N
MW378.43 g/mol
LogP4.18
Rot. Bonds8

About 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid

3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid (PubChem CID 68522894) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid.

Molecular Properties

Compound Name3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid
PubChem CID68522894
Molecular FormulaC22H22N2O4
Molecular Weight378.43 g/mol
Exact Mass378.16
IUPAC Name3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid
SMILESCOc1ccc(N(CCc2cccnc2)c2cccc(C(=O)O)c2)cc1OC
InChIInChI=1S/C22H22N2O4/c1-27-20-9-8-19(14-21(20)28-2)24(12-10-16-5-4-11-23-15-16)18-7-3-6-17(13-18)22(25)26/h3-9,11,13-15H,10,12H2,1-2H3,(H,25,26)
InChIKeyDMKWGKGPFAPKPI-UHFFFAOYSA-N
XLogP4.18
TPSA71.89 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500378.43
LogP ≤ 54.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid?
The IUPAC name of 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid (CID 68522894) is 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid.
What is the SMILES notation for 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid?
The canonical SMILES for 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid is COc1ccc(N(CCc2cccnc2)c2cccc(C(=O)O)c2)cc1OC.
What is the InChIKey of 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid?
The InChIKey is DMKWGKGPFAPKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O4/c1-27-20-9-8-19(14-21(20)28-2)24(12-10-16-5-4-11-23-15-16)18-7-3-6-17(13-18)22(25)26/h3-9,11,13-15H,10,12H2,1-2H3,(H,25,26).
What are the key properties of 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid?
3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid has a molecular weight of 378.43 g/mol, XLogP of 4.18, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid is sourced from PubChem (CID 68522894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).