C22H22N2O4 — CID 68522894
3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid (PubChem CID 68522894) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid.
| Compound Name | 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 68522894 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-[3,4-dimethoxy-N-(2-pyridin-3-ylethyl)anilino]benzoic acid |
| SMILES | COc1ccc(N(CCc2cccnc2)c2cccc(C(=O)O)c2)cc1OC |
| InChI | InChI=1S/C22H22N2O4/c1-27-20-9-8-19(14-21(20)28-2)24(12-10-16-5-4-11-23-15-16)18-7-3-6-17(13-18)22(25)26/h3-9,11,13-15H,10,12H2,1-2H3,(H,25,26) |
| InChIKey | DMKWGKGPFAPKPI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |