C29H34N2O4 — CID 10457620
tert-butyl 3-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate (PubChem CID 10457620) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl 3-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate.
| Compound Name | tert-butyl 3-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
|---|---|
| PubChem CID | 10457620 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | tert-butyl 3-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
| SMILES | COc1ccc(N(Cc2cccnc2)c2cccc(C(=O)OC(C)(C)C)c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C29H34N2O4/c1-29(2,3)35-28(32)22-10-7-11-23(17-22)31(20-21-9-8-16-30-19-21)24-14-15-26(33-4)27(18-24)34-25-12-5-6-13-25/h7-11,14-19,25H,5-6,12-13,20H2,1-4H3 |
| InChIKey | AXZNPNQZVQZTIM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |