C24H24ClFN2O2 — CID 10224353
N-(3-chloro-4-fluorophenyl)-3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)aniline (PubChem CID 10224353) has the molecular formula C24H24ClFN2O2 and a molecular weight of 426.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)aniline.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 10224353 |
| Molecular Formula | C24H24ClFN2O2 |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)aniline |
| SMILES | COc1ccc(N(Cc2cccnc2)c2ccc(F)c(Cl)c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H24ClFN2O2/c1-29-23-11-9-19(14-24(23)30-20-6-2-3-7-20)28(16-17-5-4-12-27-15-17)18-8-10-22(26)21(25)13-18/h4-5,8-15,20H,2-3,6-7,16H2,1H3 |
| InChIKey | DRKRMMJTXOKVJX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |