C23H23ClN2O3 — CID 18453298
N-(3-chlorophenyl)-4-methoxy-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)aniline (PubChem CID 18453298) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-methoxy-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)aniline.
| Compound Name | N-(3-chlorophenyl)-4-methoxy-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 18453298 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(3-chlorophenyl)-4-methoxy-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)aniline |
| SMILES | COc1ccc(N(Cc2cccnc2)c2cccc(Cl)c2)cc1OC1CCCO1 |
| InChI | InChI=1S/C23H23ClN2O3/c1-27-21-10-9-20(14-22(21)29-23-8-4-12-28-23)26(16-17-5-3-11-25-15-17)19-7-2-6-18(24)13-19/h2-3,5-7,9-11,13-15,23H,4,8,12,16H2,1H3 |
| InChIKey | WSFWQHOXVWYXPZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |