C24H22F2N2O5 — CID 68950967
3-[4-(difluoromethoxy)-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)anilino]benzoic acid (PubChem CID 68950967) has the molecular formula C24H22F2N2O5 and a molecular weight of 456.45 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)anilino]benzoic acid.
| Compound Name | 3-[4-(difluoromethoxy)-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 68950967 |
| Molecular Formula | C24H22F2N2O5 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-(oxolan-2-yloxy)-N-(pyridin-3-ylmethyl)anilino]benzoic acid |
| SMILES | O=C(O)c1cccc(N(Cc2cccnc2)c2ccc(OC(F)F)c(OC3CCCO3)c2)c1 |
| InChI | InChI=1S/C24H22F2N2O5/c25-24(26)33-20-9-8-19(13-21(20)32-22-7-3-11-31-22)28(15-16-4-2-10-27-14-16)18-6-1-5-17(12-18)23(29)30/h1-2,4-6,8-10,12-14,22,24H,3,7,11,15H2,(H,29,30) |
| InChIKey | PJBDICIEQWPXES-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |