C24H22F4N2O6 — CID 68572631
[(2R)-1,2-dihydroxypropan-2-yl] 3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]benzoate (PubChem CID 68572631) has the molecular formula C24H22F4N2O6 and a molecular weight of 510.44 g/mol. Its IUPAC name is [(2R)-1,2-dihydroxypropan-2-yl] 3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]benzoate.
| Compound Name | [(2R)-1,2-dihydroxypropan-2-yl] 3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]benzoate |
|---|---|
| PubChem CID | 68572631 |
| Molecular Formula | C24H22F4N2O6 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | [(2R)-1,2-dihydroxypropan-2-yl] 3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]benzoate |
| SMILES | C[C@](O)(CO)OC(=O)c1cccc(N(Cc2cccnc2)c2ccc(OC(F)F)c(OC(F)F)c2)c1 |
| InChI | InChI=1S/C24H22F4N2O6/c1-24(33,14-31)36-21(32)16-5-2-6-17(10-16)30(13-15-4-3-9-29-12-15)18-7-8-19(34-22(25)26)20(11-18)35-23(27)28/h2-12,22-23,31,33H,13-14H2,1H3/t24-/m1/s1 |
| InChIKey | DIFSRKDSJSFRKZ-XMMPIXPASA-N |
| XLogP | 4.48 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|