C22H22F4N4O4 — CID 68521110
2-amino-2-aminooxy-2-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]ethanol (PubChem CID 68521110) has the molecular formula C22H22F4N4O4 and a molecular weight of 482.43 g/mol. Its IUPAC name is 2-amino-2-aminooxy-2-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]ethanol.
| Compound Name | 2-amino-2-aminooxy-2-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]ethanol |
|---|---|
| PubChem CID | 68521110 |
| Molecular Formula | C22H22F4N4O4 |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-amino-2-aminooxy-2-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]ethanol |
| SMILES | NOC(N)(CO)c1cccc(N(Cc2cccnc2)c2ccc(OC(F)F)c(OC(F)F)c2)c1 |
| InChI | InChI=1S/C22H22F4N4O4/c23-20(24)32-18-7-6-17(10-19(18)33-21(25)26)30(12-14-3-2-8-29-11-14)16-5-1-4-15(9-16)22(27,13-31)34-28/h1-11,20-21,31H,12-13,27-28H2 |
| InChIKey | DUAYTXRECVEYHJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|