C42H32F4N4O2 — CID 68551398
3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)-N-[3-(1-tritylpyrazol-3-yl)phenyl]aniline (PubChem CID 68551398) has the molecular formula C42H32F4N4O2 and a molecular weight of 700.74 g/mol. Its IUPAC name is 3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)-N-[3-(1-tritylpyrazol-3-yl)phenyl]aniline.
| Compound Name | 3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)-N-[3-(1-tritylpyrazol-3-yl)phenyl]aniline |
|---|---|
| PubChem CID | 68551398 |
| Molecular Formula | C42H32F4N4O2 |
| Molecular Weight | 700.74 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | 3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)-N-[3-(1-tritylpyrazol-3-yl)phenyl]aniline |
| SMILES | FC(F)Oc1ccc(N(Cc2cccnc2)c2cccc(-c3ccn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c2)cc1OC(F)F |
| InChI | InChI=1S/C42H32F4N4O2/c43-40(44)51-38-22-21-36(27-39(38)52-41(45)46)49(29-30-12-11-24-47-28-30)35-20-10-13-31(26-35)37-23-25-50(48-37)42(32-14-4-1-5-15-32,33-16-6-2-7-17-33)34-18-8-3-9-19-34/h1-28,40-41H,29H2 |
| InChIKey | OBQRCFGIXBBAQQ-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.74 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|