C23H18F4N4O4 — CID 91100208
4-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]-5-hydroxy-1,3-dihydroimidazol-2-one (PubChem CID 91100208) has the molecular formula C23H18F4N4O4 and a molecular weight of 490.41 g/mol. Its IUPAC name is 4-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]-5-hydroxy-1,3-dihydroimidazol-2-one.
| Compound Name | 4-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]-5-hydroxy-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 91100208 |
| Molecular Formula | C23H18F4N4O4 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 4-[3-[3,4-bis(difluoromethoxy)-N-(pyridin-3-ylmethyl)anilino]phenyl]-5-hydroxy-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]c(O)c(-c2cccc(N(Cc3cccnc3)c3ccc(OC(F)F)c(OC(F)F)c3)c2)[nH]1 |
| InChI | InChI=1S/C23H18F4N4O4/c24-21(25)34-17-7-6-16(10-18(17)35-22(26)27)31(12-13-3-2-8-28-11-13)15-5-1-4-14(9-15)19-20(32)30-23(33)29-19/h1-11,21-22,32H,12H2,(H2,29,30,33) |
| InChIKey | DRBCCBOVZPQUJU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|