C27H32N2O4 — CID 91096084
tert-butyl 3-[4-methoxy-3-propoxy-N-(pyridin-3-ylmethyl)anilino]benzoate (PubChem CID 91096084) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl 3-[4-methoxy-3-propoxy-N-(pyridin-3-ylmethyl)anilino]benzoate.
| Compound Name | tert-butyl 3-[4-methoxy-3-propoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
|---|---|
| PubChem CID | 91096084 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | tert-butyl 3-[4-methoxy-3-propoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
| SMILES | CCCOc1cc(N(Cc2cccnc2)c2cccc(C(=O)OC(C)(C)C)c2)ccc1OC |
| InChI | InChI=1S/C27H32N2O4/c1-6-15-32-25-17-23(12-13-24(25)31-5)29(19-20-9-8-14-28-18-20)22-11-7-10-21(16-22)26(30)33-27(2,3)4/h7-14,16-18H,6,15,19H2,1-5H3 |
| InChIKey | CLKWPEJPEUWKMZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |