C27H25ClN2O3 — CID 10298288
3-[2-(4-chlorophenoxy)ethoxy]-4-methoxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline (PubChem CID 10298288) has the molecular formula C27H25ClN2O3 and a molecular weight of 460.96 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)ethoxy]-4-methoxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline.
| Compound Name | 3-[2-(4-chlorophenoxy)ethoxy]-4-methoxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 10298288 |
| Molecular Formula | C27H25ClN2O3 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)ethoxy]-4-methoxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline |
| SMILES | COc1ccc(N(Cc2cccnc2)c2ccccc2)cc1OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H25ClN2O3/c1-31-26-14-11-24(18-27(26)33-17-16-32-25-12-9-22(28)10-13-25)30(23-7-3-2-4-8-23)20-21-6-5-15-29-19-21/h2-15,18-19H,16-17,20H2,1H3 |
| InChIKey | NGYBATAEDWTTSV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|