C28H26ClN3O5S — CID 68953629
N-(3-chlorophenyl)sulfonyl-4-[3-ethoxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzamide (PubChem CID 68953629) has the molecular formula C28H26ClN3O5S and a molecular weight of 552.05 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfonyl-4-[3-ethoxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzamide.
| Compound Name | N-(3-chlorophenyl)sulfonyl-4-[3-ethoxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzamide |
|---|---|
| PubChem CID | 68953629 |
| Molecular Formula | C28H26ClN3O5S |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | N-(3-chlorophenyl)sulfonyl-4-[3-ethoxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzamide |
| SMILES | CCOc1cc(N(Cc2cccnc2)c2ccc(C(=O)NS(=O)(=O)c3cccc(Cl)c3)cc2)ccc1OC |
| InChI | InChI=1S/C28H26ClN3O5S/c1-3-37-27-17-24(13-14-26(27)36-2)32(19-20-6-5-15-30-18-20)23-11-9-21(10-12-23)28(33)31-38(34,35)25-8-4-7-22(29)16-25/h4-18H,3,19H2,1-2H3,(H,31,33) |
| InChIKey | ISFWFFUKSSFQNU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |