C30H39N3O5S — CID 10166259
N-[2-[4-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]phenoxy]ethyl]butane-1-sulfonamide (PubChem CID 10166259) has the molecular formula C30H39N3O5S and a molecular weight of 553.73 g/mol. Its IUPAC name is N-[2-[4-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]phenoxy]ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-[4-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]phenoxy]ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 10166259 |
| Molecular Formula | C30H39N3O5S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | N-[2-[4-[3-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]phenoxy]ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCOc1ccc(N(Cc2cccnc2)c2ccc(OC)c(OC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C30H39N3O5S/c1-3-4-20-39(34,35)32-18-19-37-27-14-11-25(12-15-27)33(23-24-8-7-17-31-22-24)26-13-16-29(36-2)30(21-26)38-28-9-5-6-10-28/h7-8,11-17,21-22,28,32H,3-6,9-10,18-20,23H2,1-2H3 |
| InChIKey | MCUUIKWXFLATEL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|