C27H33N3O3 — CID 10433759
1-N,1-N-diethyl-4-N-[4-methoxy-3-[(3R)-oxolan-3-yl]oxyphenyl]-4-N-(pyridin-3-ylmethyl)benzene-1,4-diamine (PubChem CID 10433759) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[4-methoxy-3-[(3R)-oxolan-3-yl]oxyphenyl]-4-N-(pyridin-3-ylmethyl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N-diethyl-4-N-[4-methoxy-3-[(3R)-oxolan-3-yl]oxyphenyl]-4-N-(pyridin-3-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 10433759 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[4-methoxy-3-[(3R)-oxolan-3-yl]oxyphenyl]-4-N-(pyridin-3-ylmethyl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(N(Cc2cccnc2)c2ccc(OC)c(O[C@@H]3CCOC3)c2)cc1 |
| InChI | InChI=1S/C27H33N3O3/c1-4-29(5-2)22-8-10-23(11-9-22)30(19-21-7-6-15-28-18-21)24-12-13-26(31-3)27(17-24)33-25-14-16-32-20-25/h6-13,15,17-18,25H,4-5,14,16,19-20H2,1-3H3/t25-/m1/s1 |
| InChIKey | HRFDEUJEQHQRQZ-RUZDIDTESA-N |
| XLogP | 5.44 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|