C30H36N2O4 — CID 91138588
tert-butyl 4-[3-cyclohexyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate (PubChem CID 91138588) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl 4-[3-cyclohexyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate.
| Compound Name | tert-butyl 4-[3-cyclohexyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
|---|---|
| PubChem CID | 91138588 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | tert-butyl 4-[3-cyclohexyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
| SMILES | COc1ccc(N(Cc2cccnc2)c2ccc(C(=O)OC(C)(C)C)cc2)cc1OC1CCCCC1 |
| InChI | InChI=1S/C30H36N2O4/c1-30(2,3)36-29(33)23-12-14-24(15-13-23)32(21-22-9-8-18-31-20-22)25-16-17-27(34-4)28(19-25)35-26-10-6-5-7-11-26/h8-9,12-20,26H,5-7,10-11,21H2,1-4H3 |
| InChIKey | QYCRXLPUXBTXJD-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |