C29H33FN2O4 — CID 91275164
tert-butyl 4-[5-cyclopentyloxy-2-fluoro-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate (PubChem CID 91275164) has the molecular formula C29H33FN2O4 and a molecular weight of 492.59 g/mol. Its IUPAC name is tert-butyl 4-[5-cyclopentyloxy-2-fluoro-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate.
| Compound Name | tert-butyl 4-[5-cyclopentyloxy-2-fluoro-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
|---|---|
| PubChem CID | 91275164 |
| Molecular Formula | C29H33FN2O4 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | tert-butyl 4-[5-cyclopentyloxy-2-fluoro-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoate |
| SMILES | COc1cc(F)c(N(Cc2cccnc2)c2ccc(C(=O)OC(C)(C)C)cc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C29H33FN2O4/c1-29(2,3)36-28(33)21-11-13-22(14-12-21)32(19-20-8-7-15-31-18-20)25-17-27(26(34-4)16-24(25)30)35-23-9-5-6-10-23/h7-8,11-18,23H,5-6,9-10,19H2,1-4H3 |
| InChIKey | PVRYKWHMPZLJER-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |