C25H25ClN2O4 — CID 143068802
2-[2-chloro-5-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoic acid (PubChem CID 143068802) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-[2-chloro-5-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoic acid.
| Compound Name | 2-[2-chloro-5-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 143068802 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[2-chloro-5-cyclopentyloxy-4-methoxy-N-(pyridin-3-ylmethyl)anilino]benzoic acid |
| SMILES | COc1cc(Cl)c(N(Cc2cccnc2)c2ccccc2C(=O)O)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H25ClN2O4/c1-31-23-13-20(26)22(14-24(23)32-18-8-2-3-9-18)28(16-17-7-6-12-27-15-17)21-11-5-4-10-19(21)25(29)30/h4-7,10-15,18H,2-3,8-9,16H2,1H3,(H,29,30) |
| InChIKey | RPYRWOMKDROYHR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |