C22H21FN2O2 — CID 141121071
4-fluoro-3-[(3R)-oxolan-3-yl]oxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline (PubChem CID 141121071) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-fluoro-3-[(3R)-oxolan-3-yl]oxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline.
| Compound Name | 4-fluoro-3-[(3R)-oxolan-3-yl]oxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 141121071 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-fluoro-3-[(3R)-oxolan-3-yl]oxy-N-phenyl-N-(pyridin-3-ylmethyl)aniline |
| SMILES | Fc1ccc(N(Cc2cccnc2)c2ccccc2)cc1O[C@@H]1CCOC1 |
| InChI | InChI=1S/C22H21FN2O2/c23-21-9-8-19(13-22(21)27-20-10-12-26-16-20)25(18-6-2-1-3-7-18)15-17-5-4-11-24-14-17/h1-9,11,13-14,20H,10,12,15-16H2/t20-/m1/s1 |
| InChIKey | YOOYNANHDDFAJQ-HXUWFJFHSA-N |
| XLogP | 4.73 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |