C21H16F2N2O5 — CID 10431924
3-[4-(difluoromethoxy)-3-methoxy-N-(pyridine-3-carbonyl)anilino]benzoic acid (PubChem CID 10431924) has the molecular formula C21H16F2N2O5 and a molecular weight of 414.36 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxy-N-(pyridine-3-carbonyl)anilino]benzoic acid.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxy-N-(pyridine-3-carbonyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 10431924 |
| Molecular Formula | C21H16F2N2O5 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxy-N-(pyridine-3-carbonyl)anilino]benzoic acid |
| SMILES | COc1cc(N(C(=O)c2cccnc2)c2cccc(C(=O)O)c2)ccc1OC(F)F |
| InChI | InChI=1S/C21H16F2N2O5/c1-29-18-11-16(7-8-17(18)30-21(22)23)25(19(26)14-5-3-9-24-12-14)15-6-2-4-13(10-15)20(27)28/h2-12,21H,1H3,(H,27,28) |
| InChIKey | JFZFVKOMZXEAOE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |