C20H14F4N2O3 — CID 141089286
N-[2,3-bis(difluoromethoxy)phenyl]-N-phenylpyridine-3-carboxamide (PubChem CID 141089286) has the molecular formula C20H14F4N2O3 and a molecular weight of 406.34 g/mol. Its IUPAC name is N-[2,3-bis(difluoromethoxy)phenyl]-N-phenylpyridine-3-carboxamide.
| Compound Name | N-[2,3-bis(difluoromethoxy)phenyl]-N-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 141089286 |
| Molecular Formula | C20H14F4N2O3 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[2,3-bis(difluoromethoxy)phenyl]-N-phenylpyridine-3-carboxamide |
| SMILES | O=C(c1cccnc1)N(c1ccccc1)c1cccc(OC(F)F)c1OC(F)F |
| InChI | InChI=1S/C20H14F4N2O3/c21-19(22)28-16-10-4-9-15(17(16)29-20(23)24)26(14-7-2-1-3-8-14)18(27)13-6-5-11-25-12-13/h1-12,19-20H |
| InChIKey | XHDXHMKZAACDBH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |