C19H22O4 — CID 135057699
1-[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]ethanone (PubChem CID 135057699) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]ethanone.
| Compound Name | 1-[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]ethanone |
|---|---|
| PubChem CID | 135057699 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]ethanone |
| SMILES | COc1cc(CCc2ccccc2C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H22O4/c1-13(20)16-8-6-5-7-15(16)10-9-14-11-17(21-2)19(23-4)18(12-14)22-3/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | BAXALCFSTHMPGO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |