C24H26O7 — CID 101474657
2,2-dimethyl-5-[[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 101474657) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 101474657 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2,2-dimethyl-5-[[2-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | COc1cc(CCc2ccccc2C=C2C(=O)OC(C)(C)OC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H26O7/c1-24(2)30-22(25)18(23(26)31-24)14-17-9-7-6-8-16(17)11-10-15-12-19(27-3)21(29-5)20(13-15)28-4/h6-9,12-14H,10-11H2,1-5H3 |
| InChIKey | OPESLXLWPLLLOC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|