C19H18O6 — CID 168599232
5-[(3,5-dimethoxynaphthalen-2-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599232) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 5-[(3,5-dimethoxynaphthalen-2-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3,5-dimethoxynaphthalen-2-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599232 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5-[(3,5-dimethoxynaphthalen-2-yl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc2c(OC)cccc2cc1C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C19H18O6/c1-19(2)24-17(20)14(18(21)25-19)9-12-8-11-6-5-7-15(22-3)13(11)10-16(12)23-4/h5-10H,1-4H3 |
| InChIKey | BZTAMPTZOXHBNZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|