C14H15BO7 — CID 168599060
[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-4-methoxyphenyl]boronic acid (PubChem CID 168599060) has the molecular formula C14H15BO7 and a molecular weight of 306.08 g/mol. Its IUPAC name is [3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-4-methoxyphenyl]boronic acid.
| Compound Name | [3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168599060 |
| Molecular Formula | C14H15BO7 |
| Molecular Weight | 306.08 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-4-methoxyphenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)cc1C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C14H15BO7/c1-14(2)21-12(16)10(13(17)22-14)7-8-6-9(15(18)19)4-5-11(8)20-3/h4-7,18-19H,1-3H3 |
| InChIKey | QDNWVCJPXHMJMC-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.08 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|