C14H15BO6 — CID 168599872
[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-methylphenyl]boronic acid (PubChem CID 168599872) has the molecular formula C14H15BO6 and a molecular weight of 290.08 g/mol. Its IUPAC name is [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-methylphenyl]boronic acid.
| Compound Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 168599872 |
| Molecular Formula | C14H15BO6 |
| Molecular Weight | 290.08 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-methylphenyl]boronic acid |
| SMILES | Cc1cc(B(O)O)ccc1C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C14H15BO6/c1-8-6-10(15(18)19)5-4-9(8)7-11-12(16)20-14(2,3)21-13(11)17/h4-7,18-19H,1-3H3 |
| InChIKey | CTPKVOONIVOMNL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.08 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|