C17H20O5 — CID 146465805
4-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,3-diol (PubChem CID 146465805) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,3-diol.
| Compound Name | 4-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 146465805 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,3-diol |
| SMILES | COc1cc(CCc2ccc(O)cc2O)cc(OC)c1OC |
| InChI | InChI=1S/C17H20O5/c1-20-15-8-11(9-16(21-2)17(15)22-3)4-5-12-6-7-13(18)10-14(12)19/h6-10,18-19H,4-5H2,1-3H3 |
| InChIKey | BRPASYNBUKHATN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |