C18H23NO5 — CID 118422161
2-amino-6-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol (PubChem CID 118422161) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-amino-6-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol.
| Compound Name | 2-amino-6-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 118422161 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-amino-6-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol |
| SMILES | COc1ccc(CCc2cc(OC)c(OC)c(OC)c2)c(N)c1O |
| InChI | InChI=1S/C18H23NO5/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h7-10,20H,5-6,19H2,1-4H3 |
| InChIKey | BQKYLOLBOMVSOU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|