C22H30O8 — CID 11373561
1,2,3-trimethoxy-5-[2-[4-methoxy-2,3-bis(methoxymethoxy)phenyl]ethyl]benzene (PubChem CID 11373561) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[2-[4-methoxy-2,3-bis(methoxymethoxy)phenyl]ethyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[2-[4-methoxy-2,3-bis(methoxymethoxy)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 11373561 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1,2,3-trimethoxy-5-[2-[4-methoxy-2,3-bis(methoxymethoxy)phenyl]ethyl]benzene |
| SMILES | COCOc1c(CCc2cc(OC)c(OC)c(OC)c2)ccc(OC)c1OCOC |
| InChI | InChI=1S/C22H30O8/c1-23-13-29-20-16(9-10-17(25-3)22(20)30-14-24-2)8-7-15-11-18(26-4)21(28-6)19(12-15)27-5/h9-12H,7-8,13-14H2,1-6H3 |
| InChIKey | DYZUNHDHGKCTMR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|