C15H22O6 — CID 19816113
5-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]pentanoic acid (PubChem CID 19816113) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]pentanoic acid.
| Compound Name | 5-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 19816113 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]pentanoic acid |
| SMILES | COCOc1c(OC)cc(CCCCC(=O)O)cc1OC |
| InChI | InChI=1S/C15H22O6/c1-18-10-21-15-12(19-2)8-11(9-13(15)20-3)6-4-5-7-14(16)17/h8-9H,4-7,10H2,1-3H3,(H,16,17) |
| InChIKey | CHCSPMJHTSULTB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|