C38H46O10 — CID 172870474
1-[2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene (PubChem CID 172870474) has the molecular formula C38H46O10 and a molecular weight of 662.78 g/mol. Its IUPAC name is 1-[2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene.
| Compound Name | 1-[2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 172870474 |
| Molecular Formula | C38H46O10 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | 1-[2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl]-2,4-dimethoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene |
| SMILES | COc1cc(OC)c(-c2cc(CCc3cc(OC)c(OC)c(OC)c3)c(OC)cc2OC)cc1CCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C38H46O10/c1-39-29-21-31(41-3)27(19-25(29)13-11-23-15-33(43-5)37(47-9)34(16-23)44-6)28-20-26(30(40-2)22-32(28)42-4)14-12-24-17-35(45-7)38(48-10)36(18-24)46-8/h15-22H,11-14H2,1-10H3 |
| InChIKey | VQBMVFJUUBEHFN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |