C12H17IO3 — CID 10640570
5-(3-iodopropyl)-1,2,3-trimethoxybenzene (PubChem CID 10640570) has the molecular formula C12H17IO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is 5-(3-iodopropyl)-1,2,3-trimethoxybenzene.
| Compound Name | 5-(3-iodopropyl)-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 10640570 |
| Molecular Formula | C12H17IO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5-(3-iodopropyl)-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(CCCI)cc(OC)c1OC |
| InChI | InChI=1S/C12H17IO3/c1-14-10-7-9(5-4-6-13)8-11(15-2)12(10)16-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | YZJPHEIDTXYDSE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|